ChemNet > CAS > 55690-60-3 2-Mercapto-5-methoxybenzothiazole
55690-60-3 2-Mercapto-5-methoxybenzothiazole
| product Name |
2-Mercapto-5-methoxybenzothiazole |
| CAS No |
55690-60-3 |
| Synonyms |
5-Methoxybenzothiazole-2-thiol; 5-methoxy-1,3-benzothiazole-2(3H)-thione; 5-Methoxybenzo[d]thiazole-2-thiol |
| Molecular Formula |
C8H7NOS2 |
| Molecular Weight |
197.2773 |
| InChI |
InChI=1/C8H7NOS2/c1-10-5-2-3-7-6(4-5)9-8(11)12-7/h2-4H,1H3,(H,9,11) |
| EINECS |
259-755-1 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Boiling point |
340.8°C at 760 mmHg |
| Refractive index |
1.728 |
| Flash point |
159.9°C |
| Vapour Pressur |
8.38E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
